C30H35NO3 — CID 71043693
methyl 2-[4-[[2-[3-(dimethylamino)propyl]-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]oxymethyl]phenyl]acetate (PubChem CID 71043693) has the molecular formula C30H35NO3 and a molecular weight of 457.61 g/mol. Its IUPAC name is methyl 2-[4-[[2-[3-(dimethylamino)propyl]-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]oxymethyl]phenyl]acetate.
| Compound Name | methyl 2-[4-[[2-[3-(dimethylamino)propyl]-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]oxymethyl]phenyl]acetate |
|---|---|
| PubChem CID | 71043693 |
| Molecular Formula | C30H35NO3 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | methyl 2-[4-[[2-[3-(dimethylamino)propyl]-6-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl]oxymethyl]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(COc2ccc3c(c2)CCc2ccccc2C3CCCN(C)C)cc1 |
| InChI | InChI=1S/C30H35NO3/c1-31(2)18-6-9-29-27-8-5-4-7-24(27)14-15-25-20-26(16-17-28(25)29)34-21-23-12-10-22(11-13-23)19-30(32)33-3/h4-5,7-8,10-13,16-17,20,29H,6,9,14-15,18-19,21H2,1-3H3 |
| InChIKey | TWZHCBYEEYCKFD-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |