About 5-methyl-3-[(E,4S)-4-methylhex-2-en-2-yl]oxy-3a,7a-dihydro-1H-indole
5-methyl-3-[(E,4S)-4-methylhex-2-en-2-yl]oxy-3a,7a-dihydro-1H-indole (PubChem CID 71043782) has the molecular formula C16H23NO
and a molecular weight of 245.37 g/mol. Its IUPAC name is 5-methyl-3-[(E,4S)-4-methylhex-2-en-2-yl]oxy-3a,7a-dihydro-1H-indole.
Molecular Properties
| Compound Name | 5-methyl-3-[(E,4S)-4-methylhex-2-en-2-yl]oxy-3a,7a-dihydro-1H-indole |
| PubChem CID | 71043782 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 5-methyl-3-[(E,4S)-4-methylhex-2-en-2-yl]oxy-3a,7a-dihydro-1H-indole |
| SMILES | CC[C@H](C)/C=C(\C)OC1=CNC2C=CC(C)=CC12 |
| InChI | InChI=1S/C16H23NO/c1-5-11(2)8-13(4)18-16-10-17-15-7-6-12(3)9-14(15)16/h6-11,14-15,17H,5H2,1-4H3/b13-8+/t11-,14?,15?/m0/s1 |
| InChIKey | WAKURMQMHGDWEM-BMHANICPSA-N |
| XLogP | 3.90 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-3-[(E,4S)-4-methylhex-2-en-2-yl]oxy-3a,7a-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-[(E,4S)-4-methylhex-2-en-2-yl]oxy-3a,7a-dihydro-1H-indole?
The IUPAC name of 5-methyl-3-[(E,4S)-4-methylhex-2-en-2-yl]oxy-3a,7a-dihydro-1H-indole (CID 71043782) is 5-methyl-3-[(E,4S)-4-methylhex-2-en-2-yl]oxy-3a,7a-dihydro-1H-indole.
What is the SMILES notation for 5-methyl-3-[(E,4S)-4-methylhex-2-en-2-yl]oxy-3a,7a-dihydro-1H-indole?
The canonical SMILES for 5-methyl-3-[(E,4S)-4-methylhex-2-en-2-yl]oxy-3a,7a-dihydro-1H-indole is CC[C@H](C)/C=C(\C)OC1=CNC2C=CC(C)=CC12.
What is the InChIKey of 5-methyl-3-[(E,4S)-4-methylhex-2-en-2-yl]oxy-3a,7a-dihydro-1H-indole?
The InChIKey is WAKURMQMHGDWEM-BMHANICPSA-N. The full InChI is InChI=1S/C16H23NO/c1-5-11(2)8-13(4)18-16-10-17-15-7-6-12(3)9-14(15)16/h6-11,14-15,17H,5H2,1-4H3/b13-8+/t11-,14?,15?/m0/s1.
What are the key properties of 5-methyl-3-[(E,4S)-4-methylhex-2-en-2-yl]oxy-3a,7a-dihydro-1H-indole?
5-methyl-3-[(E,4S)-4-methylhex-2-en-2-yl]oxy-3a,7a-dihydro-1H-indole has a molecular weight of 245.37 g/mol, XLogP of 3.90, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-[(E,4S)-4-methylhex-2-en-2-yl]oxy-3a,7a-dihydro-1H-indole is sourced from PubChem (CID 71043782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).