About 3-ethyl-6-(2-ethylhexoxy)-1,5-dimethoxycyclohexene
3-ethyl-6-(2-ethylhexoxy)-1,5-dimethoxycyclohexene (PubChem CID 71044018) has the molecular formula C18H34O3
and a molecular weight of 298.47 g/mol. Its IUPAC name is 3-ethyl-6-(2-ethylhexoxy)-1,5-dimethoxycyclohexene.
Molecular Properties
| Compound Name | 3-ethyl-6-(2-ethylhexoxy)-1,5-dimethoxycyclohexene |
| PubChem CID | 71044018 |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | 3-ethyl-6-(2-ethylhexoxy)-1,5-dimethoxycyclohexene |
| SMILES | CCCCC(CC)COC1C(OC)=CC(CC)CC1OC |
| InChI | InChI=1S/C18H34O3/c1-6-9-10-14(7-2)13-21-18-16(19-4)11-15(8-3)12-17(18)20-5/h11,14-15,17-18H,6-10,12-13H2,1-5H3 |
| InChIKey | KJEVZSYYMUUXJT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-6-(2-ethylhexoxy)-1,5-dimethoxycyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-6-(2-ethylhexoxy)-1,5-dimethoxycyclohexene?
The IUPAC name of 3-ethyl-6-(2-ethylhexoxy)-1,5-dimethoxycyclohexene (CID 71044018) is 3-ethyl-6-(2-ethylhexoxy)-1,5-dimethoxycyclohexene.
What is the SMILES notation for 3-ethyl-6-(2-ethylhexoxy)-1,5-dimethoxycyclohexene?
The canonical SMILES for 3-ethyl-6-(2-ethylhexoxy)-1,5-dimethoxycyclohexene is CCCCC(CC)COC1C(OC)=CC(CC)CC1OC.
What is the InChIKey of 3-ethyl-6-(2-ethylhexoxy)-1,5-dimethoxycyclohexene?
The InChIKey is KJEVZSYYMUUXJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O3/c1-6-9-10-14(7-2)13-21-18-16(19-4)11-15(8-3)12-17(18)20-5/h11,14-15,17-18H,6-10,12-13H2,1-5H3.
What are the key properties of 3-ethyl-6-(2-ethylhexoxy)-1,5-dimethoxycyclohexene?
3-ethyl-6-(2-ethylhexoxy)-1,5-dimethoxycyclohexene has a molecular weight of 298.47 g/mol, XLogP of 4.56, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-6-(2-ethylhexoxy)-1,5-dimethoxycyclohexene is sourced from PubChem (CID 71044018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).