C29H28N6O4 — CID 71044040
methyl 2-methoxy-5-[3-[2-[3-[2-(methylamino)ethoxy]anilino]pyrimidin-4-yl]imidazo[1,2-a]pyridin-2-yl]benzoate (PubChem CID 71044040) has the molecular formula C29H28N6O4 and a molecular weight of 524.58 g/mol. Its IUPAC name is methyl 2-methoxy-5-[3-[2-[3-[2-(methylamino)ethoxy]anilino]pyrimidin-4-yl]imidazo[1,2-a]pyridin-2-yl]benzoate.
| Compound Name | methyl 2-methoxy-5-[3-[2-[3-[2-(methylamino)ethoxy]anilino]pyrimidin-4-yl]imidazo[1,2-a]pyridin-2-yl]benzoate |
|---|---|
| PubChem CID | 71044040 |
| Molecular Formula | C29H28N6O4 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | methyl 2-methoxy-5-[3-[2-[3-[2-(methylamino)ethoxy]anilino]pyrimidin-4-yl]imidazo[1,2-a]pyridin-2-yl]benzoate |
| SMILES | CNCCOc1cccc(Nc2nccc(-c3c(-c4ccc(OC)c(C(=O)OC)c4)nc4ccccn34)n2)c1 |
| InChI | InChI=1S/C29H28N6O4/c1-30-14-16-39-21-8-6-7-20(18-21)32-29-31-13-12-23(33-29)27-26(34-25-9-4-5-15-35(25)27)19-10-11-24(37-2)22(17-19)28(36)38-3/h4-13,15,17-18,30H,14,16H2,1-3H3,(H,31,32,33) |
| InChIKey | IIVOSUWUQFPBQP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|