About (5-butoxycyclohexa-1,5-dien-1-yl)oxy-trimethylsilane
(5-butoxycyclohexa-1,5-dien-1-yl)oxy-trimethylsilane (PubChem CID 71044314) has the molecular formula C13H24O2Si
and a molecular weight of 240.42 g/mol. Its IUPAC name is (5-butoxycyclohexa-1,5-dien-1-yl)oxy-trimethylsilane.
Molecular Properties
| Compound Name | (5-butoxycyclohexa-1,5-dien-1-yl)oxy-trimethylsilane |
| PubChem CID | 71044314 |
| Molecular Formula | C13H24O2Si |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | (5-butoxycyclohexa-1,5-dien-1-yl)oxy-trimethylsilane |
| SMILES | CCCCOC1=CC(O[Si](C)(C)C)=CCC1 |
| InChI | InChI=1S/C13H24O2Si/c1-5-6-10-14-12-8-7-9-13(11-12)15-16(2,3)4/h9,11H,5-8,10H2,1-4H3 |
| InChIKey | KNCGXJVFFLGWNK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (5-butoxycyclohexa-1,5-dien-1-yl)oxy-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-butoxycyclohexa-1,5-dien-1-yl)oxy-trimethylsilane?
The IUPAC name of (5-butoxycyclohexa-1,5-dien-1-yl)oxy-trimethylsilane (CID 71044314) is (5-butoxycyclohexa-1,5-dien-1-yl)oxy-trimethylsilane.
What is the SMILES notation for (5-butoxycyclohexa-1,5-dien-1-yl)oxy-trimethylsilane?
The canonical SMILES for (5-butoxycyclohexa-1,5-dien-1-yl)oxy-trimethylsilane is CCCCOC1=CC(O[Si](C)(C)C)=CCC1.
What is the InChIKey of (5-butoxycyclohexa-1,5-dien-1-yl)oxy-trimethylsilane?
The InChIKey is KNCGXJVFFLGWNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2Si/c1-5-6-10-14-12-8-7-9-13(11-12)15-16(2,3)4/h9,11H,5-8,10H2,1-4H3.
What are the key properties of (5-butoxycyclohexa-1,5-dien-1-yl)oxy-trimethylsilane?
(5-butoxycyclohexa-1,5-dien-1-yl)oxy-trimethylsilane has a molecular weight of 240.42 g/mol, XLogP of 4.22, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-butoxycyclohexa-1,5-dien-1-yl)oxy-trimethylsilane is sourced from PubChem (CID 71044314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).