C23H24N4O — CID 71044496
1-(2'-methylspiro[1,3-dihydroindene-2,8'-3,6,7,9-tetrahydroimidazo[4,5-h]quinoline]-5'-yl)pyrrolidin-2-one (PubChem CID 71044496) has the molecular formula C23H24N4O and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-(2'-methylspiro[1,3-dihydroindene-2,8'-3,6,7,9-tetrahydroimidazo[4,5-h]quinoline]-5'-yl)pyrrolidin-2-one.
| Compound Name | 1-(2'-methylspiro[1,3-dihydroindene-2,8'-3,6,7,9-tetrahydroimidazo[4,5-h]quinoline]-5'-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 71044496 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 1-(2'-methylspiro[1,3-dihydroindene-2,8'-3,6,7,9-tetrahydroimidazo[4,5-h]quinoline]-5'-yl)pyrrolidin-2-one |
| SMILES | Cc1nc2c3c(c(N4CCCC4=O)cc2[nH]1)CCC1(Cc2ccccc2C1)N3 |
| InChI | InChI=1S/C23H24N4O/c1-14-24-18-11-19(27-10-4-7-20(27)28)17-8-9-23(26-21(17)22(18)25-14)12-15-5-2-3-6-16(15)13-23/h2-3,5-6,11,26H,4,7-10,12-13H2,1H3,(H,24,25) |
| InChIKey | GXCNVOLQMUZTQZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |