C19H30O5 — CID 71045029
1,4'-diethyl-6,6',8-trimethylspiro[7,9,11-trioxatricyclo[6.2.1.02,6]undecane-10,5'-oxane]-2'-one (PubChem CID 71045029) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is 1,4'-diethyl-6,6',8-trimethylspiro[7,9,11-trioxatricyclo[6.2.1.02,6]undecane-10,5'-oxane]-2'-one.
| Compound Name | 1,4'-diethyl-6,6',8-trimethylspiro[7,9,11-trioxatricyclo[6.2.1.02,6]undecane-10,5'-oxane]-2'-one |
|---|---|
| PubChem CID | 71045029 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 1,4'-diethyl-6,6',8-trimethylspiro[7,9,11-trioxatricyclo[6.2.1.02,6]undecane-10,5'-oxane]-2'-one |
| SMILES | CCC1CC(=O)OC(C)C12OC1(C)OC3(C)CCCC3C2(CC)O1 |
| InChI | InChI=1S/C19H30O5/c1-6-13-11-15(20)21-12(3)19(13)18(7-2)14-9-8-10-16(14,4)22-17(5,23-18)24-19/h12-14H,6-11H2,1-5H3 |
| InChIKey | RUDJBAQXUZZSSU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |