C32H43NO12 — CID 71045030
methyl 2-[7-[1-(2-aminoacetyl)oxy-1-(furan-3-yl)-2-methylpropan-2-yl]-12-ethyl-2,18-dihydroxy-10,13,15-trimethyl-5-oxo-4,9,11,17-tetraoxahexacyclo[8.6.1.12,15.01,13.03,8.08,12]octadecan-14-yl]acetate (PubChem CID 71045030) has the molecular formula C32H43NO12 and a molecular weight of 633.69 g/mol. Its IUPAC name is methyl 2-[7-[1-(2-aminoacetyl)oxy-1-(furan-3-yl)-2-methylpropan-2-yl]-12-ethyl-2,18-dihydroxy-10,13,15-trimethyl-5-oxo-4,9,11,17-tetraoxahexacyclo[8.6.1.12,15.01,13.03,8.08,12]octadecan-14-yl]acetate.
| Compound Name | methyl 2-[7-[1-(2-aminoacetyl)oxy-1-(furan-3-yl)-2-methylpropan-2-yl]-12-ethyl-2,18-dihydroxy-10,13,15-trimethyl-5-oxo-4,9,11,17-tetraoxahexacyclo[8.6.1.12,15.01,13.03,8.08,12]octadecan-14-yl]acetate |
|---|---|
| PubChem CID | 71045030 |
| Molecular Formula | C32H43NO12 |
| Molecular Weight | 633.69 g/mol |
| Exact Mass | 633.28 |
| IUPAC Name | methyl 2-[7-[1-(2-aminoacetyl)oxy-1-(furan-3-yl)-2-methylpropan-2-yl]-12-ethyl-2,18-dihydroxy-10,13,15-trimethyl-5-oxo-4,9,11,17-tetraoxahexacyclo[8.6.1.12,15.01,13.03,8.08,12]octadecan-14-yl]acetate |
| SMILES | CCC12OC3(C)OC14C(C(C)(C)C(OC(=O)CN)c1ccoc1)CC(=O)OC4C1(O)C(O)C4(C)CC1(O3)C2(C)C4CC(=O)OC |
| InChI | InChI=1S/C32H43NO12/c1-8-29-27(5)18(12-19(34)39-7)26(4)15-30(27)31(38,23(26)37)24-32(29,45-28(6,43-29)44-30)17(11-20(35)42-24)25(2,3)22(41-21(36)13-33)16-9-10-40-14-16/h9-10,14,17-18,22-24,37-38H,8,11-13,15,33H2,1-7H3 |
| InChIKey | CYVHSQRKYQCUGT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 186.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.69 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|