C26H29N3O4 — CID 71045102
ethyl 3-[4-[2-(2-methyl-5-phenyl-2,3-dihydro-1H-pyrrol-3-yl)-2-oxoacetyl]piperazin-1-yl]benzoate (PubChem CID 71045102) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is ethyl 3-[4-[2-(2-methyl-5-phenyl-2,3-dihydro-1H-pyrrol-3-yl)-2-oxoacetyl]piperazin-1-yl]benzoate.
| Compound Name | ethyl 3-[4-[2-(2-methyl-5-phenyl-2,3-dihydro-1H-pyrrol-3-yl)-2-oxoacetyl]piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 71045102 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | ethyl 3-[4-[2-(2-methyl-5-phenyl-2,3-dihydro-1H-pyrrol-3-yl)-2-oxoacetyl]piperazin-1-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(N2CCN(C(=O)C(=O)C3C=C(c4ccccc4)NC3C)CC2)c1 |
| InChI | InChI=1S/C26H29N3O4/c1-3-33-26(32)20-10-7-11-21(16-20)28-12-14-29(15-13-28)25(31)24(30)22-17-23(27-18(22)2)19-8-5-4-6-9-19/h4-11,16-18,22,27H,3,12-15H2,1-2H3 |
| InChIKey | LWBNKLCYMKIXCU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|