C15H24BN2O3 — CID 71045122
CID 71045122 (PubChem CID 71045122) has the molecular formula C15H24BN2O3 and a molecular weight of 291.18 g/mol.
| Compound Name | CID 71045122 |
|---|---|
| PubChem CID | 71045122 |
| Molecular Formula | C15H24BN2O3 |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | — |
| SMILES | CO[B]NC(C)(C)[C@H](N[C@@H](C)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C15H24BN2O3/c1-11(12-9-7-6-8-10-12)17-13(14(19)20-4)15(2,3)18-16-21-5/h6-11,13,17-18H,1-5H3/t11-,13+/m0/s1 |
| InChIKey | MJFQLUMDNWXOOQ-WCQYABFASA-N |
| XLogP | 1.43 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|