C23H34O3 — CID 71045967
(1R,5S,8S,10S,17S)-8-hydroxy-5-methyl-18-oxahexacyclo[12.9.0.01,17.04,13.05,10.017,22]tricosan-19-one (PubChem CID 71045967) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is (1R,5S,8S,10S,17S)-8-hydroxy-5-methyl-18-oxahexacyclo[12.9.0.01,17.04,13.05,10.017,22]tricosan-19-one.
| Compound Name | (1R,5S,8S,10S,17S)-8-hydroxy-5-methyl-18-oxahexacyclo[12.9.0.01,17.04,13.05,10.017,22]tricosan-19-one |
|---|---|
| PubChem CID | 71045967 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | (1R,5S,8S,10S,17S)-8-hydroxy-5-methyl-18-oxahexacyclo[12.9.0.01,17.04,13.05,10.017,22]tricosan-19-one |
| SMILES | C[C@]12CC[C@H](O)C[C@@H]1CCC1C3CC[C@]45OC(=O)CCC4C[C@]35CCC12 |
| InChI | InChI=1S/C23H34O3/c1-21-9-6-16(24)12-14(21)2-4-17-18(21)7-10-22-13-15-3-5-20(25)26-23(15,22)11-8-19(17)22/h14-19,24H,2-13H2,1H3/t14-,15?,16-,17?,18?,19?,21-,22+,23-/m0/s1 |
| InChIKey | AEAMWEGVMMGNCT-IIOYWMTGSA-N |
| XLogP | 4.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |