C43H65O3P — CID 71046445
2,4,8,10-tetratert-butyl-6-(2,4-ditert-butyl-6-methylphenoxy)-8,9-dihydrobenzo[d][1,3,2]benzodioxaphosphepine (PubChem CID 71046445) has the molecular formula C43H65O3P and a molecular weight of 660.96 g/mol. Its IUPAC name is 2,4,8,10-tetratert-butyl-6-(2,4-ditert-butyl-6-methylphenoxy)-8,9-dihydrobenzo[d][1,3,2]benzodioxaphosphepine.
| Compound Name | 2,4,8,10-tetratert-butyl-6-(2,4-ditert-butyl-6-methylphenoxy)-8,9-dihydrobenzo[d][1,3,2]benzodioxaphosphepine |
|---|---|
| PubChem CID | 71046445 |
| Molecular Formula | C43H65O3P |
| Molecular Weight | 660.96 g/mol |
| Exact Mass | 660.47 |
| IUPAC Name | 2,4,8,10-tetratert-butyl-6-(2,4-ditert-butyl-6-methylphenoxy)-8,9-dihydrobenzo[d][1,3,2]benzodioxaphosphepine |
| SMILES | Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1Op1oc2c(c3cc(C(C)(C)C)cc(C(C)(C)C)c3o1)C=C(C(C)(C)C)CC2C(C)(C)C |
| InChI | InChI=1S/C43H65O3P/c1-26-20-27(38(2,3)4)23-32(41(11,12)13)35(26)44-47-45-36-30(21-28(39(5,6)7)24-33(36)42(14,15)16)31-22-29(40(8,9)10)25-34(37(31)46-47)43(17,18)19/h20-24,34H,25H2,1-19H3 |
| InChIKey | MYCGDQGQJLYKSL-UHFFFAOYSA-N |
| XLogP | 14.44 |
| TPSA | 35.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.96 |
| LogP ≤ 5 | 14.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |