C19H26BrNO2 — CID 71046530
9-bromo-7-methoxy-2,5',6-trimethylspiro[3,4-dihydro-1H-2-benzazepine-5,4'-cyclohex-2-ene]-1'-ol (PubChem CID 71046530) has the molecular formula C19H26BrNO2 and a molecular weight of 380.33 g/mol. Its IUPAC name is 9-bromo-7-methoxy-2,5',6-trimethylspiro[3,4-dihydro-1H-2-benzazepine-5,4'-cyclohex-2-ene]-1'-ol.
| Compound Name | 9-bromo-7-methoxy-2,5',6-trimethylspiro[3,4-dihydro-1H-2-benzazepine-5,4'-cyclohex-2-ene]-1'-ol |
|---|---|
| PubChem CID | 71046530 |
| Molecular Formula | C19H26BrNO2 |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 9-bromo-7-methoxy-2,5',6-trimethylspiro[3,4-dihydro-1H-2-benzazepine-5,4'-cyclohex-2-ene]-1'-ol |
| SMILES | COc1cc(Br)c2c(c1C)C1(C=CC(O)CC1C)CCN(C)C2 |
| InChI | InChI=1S/C19H26BrNO2/c1-12-9-14(22)5-6-19(12)7-8-21(3)11-15-16(20)10-17(23-4)13(2)18(15)19/h5-6,10,12,14,22H,7-9,11H2,1-4H3 |
| InChIKey | WNFFLJYOVJTNPB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|