C13H14N4O2S2 — CID 71046683
5-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]-1-ethyl-2,3-dihydroindole-2-carboxylic acid (PubChem CID 71046683) has the molecular formula C13H14N4O2S2 and a molecular weight of 322.42 g/mol. Its IUPAC name is 5-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]-1-ethyl-2,3-dihydroindole-2-carboxylic acid.
| Compound Name | 5-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]-1-ethyl-2,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 71046683 |
| Molecular Formula | C13H14N4O2S2 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 5-[3,5-bis(sulfanylidene)-1,2,4-triazolidin-4-yl]-1-ethyl-2,3-dihydroindole-2-carboxylic acid |
| SMILES | CCN1c2ccc(-n3c(=S)[nH][nH]c3=S)cc2CC1C(=O)O |
| InChI | InChI=1S/C13H14N4O2S2/c1-2-16-9-4-3-8(17-12(20)14-15-13(17)21)5-7(9)6-10(16)11(18)19/h3-5,10H,2,6H2,1H3,(H,14,20)(H,15,21)(H,18,19) |
| InChIKey | UYMSSHZFISPYHY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 77.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|