C19H30OSi — CID 71047224
[(4R,5R)-4,7-dimethylspiro[4,5-dihydroindene-6,1'-cyclopropane]-5-yl]oxy-triethylsilane (PubChem CID 71047224) has the molecular formula C19H30OSi and a molecular weight of 302.53 g/mol. Its IUPAC name is [(4R,5R)-4,7-dimethylspiro[4,5-dihydroindene-6,1'-cyclopropane]-5-yl]oxy-triethylsilane.
| Compound Name | [(4R,5R)-4,7-dimethylspiro[4,5-dihydroindene-6,1'-cyclopropane]-5-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 71047224 |
| Molecular Formula | C19H30OSi |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | [(4R,5R)-4,7-dimethylspiro[4,5-dihydroindene-6,1'-cyclopropane]-5-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@H](C)C2=CC=CC2=C(C)C12CC2 |
| InChI | InChI=1S/C19H30OSi/c1-6-21(7-2,8-3)20-18-14(4)16-10-9-11-17(16)15(5)19(18)12-13-19/h9-11,14,18H,6-8,12-13H2,1-5H3/t14-,18-/m1/s1 |
| InChIKey | GEXDDUUNEZSOMV-RDTXWAMCSA-N |
| XLogP | 5.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|