C13H20N2 — CID 71047571
(1S,7R,14R)-2,13-diazatetracyclo[6.6.1.02,7.09,14]pentadec-8-ene (PubChem CID 71047571) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (1S,7R,14R)-2,13-diazatetracyclo[6.6.1.02,7.09,14]pentadec-8-ene.
| Compound Name | (1S,7R,14R)-2,13-diazatetracyclo[6.6.1.02,7.09,14]pentadec-8-ene |
|---|---|
| PubChem CID | 71047571 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (1S,7R,14R)-2,13-diazatetracyclo[6.6.1.02,7.09,14]pentadec-8-ene |
| SMILES | C1CN[C@@H]2C(=C3C[C@@H]2N2CCCC[C@H]32)C1 |
| InChI | InChI=1S/C13H20N2/c1-2-7-15-11(5-1)10-8-12(15)13-9(10)4-3-6-14-13/h11-14H,1-8H2/t11-,12+,13-/m1/s1 |
| InChIKey | QFQTUZDPEMXTGK-FRRDWIJNSA-N |
| XLogP | 1.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|