C17H28O7 — CID 71047799
[(2S,4S)-4,5-diacetyloxy-6-tert-butyl-3-methyloxan-2-yl]methyl acetate (PubChem CID 71047799) has the molecular formula C17H28O7 and a molecular weight of 344.40 g/mol. Its IUPAC name is [(2S,4S)-4,5-diacetyloxy-6-tert-butyl-3-methyloxan-2-yl]methyl acetate.
| Compound Name | [(2S,4S)-4,5-diacetyloxy-6-tert-butyl-3-methyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71047799 |
| Molecular Formula | C17H28O7 |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | [(2S,4S)-4,5-diacetyloxy-6-tert-butyl-3-methyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(C(C)(C)C)C(OC(C)=O)[C@@H](OC(C)=O)C1C |
| InChI | InChI=1S/C17H28O7/c1-9-13(8-21-10(2)18)24-16(17(5,6)7)15(23-12(4)20)14(9)22-11(3)19/h9,13-16H,8H2,1-7H3/t9?,13-,14+,15?,16?/m1/s1 |
| InChIKey | JNCBMSVQTKXXNG-XBKZMQDMSA-N |
| XLogP | 1.86 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|