About ethyl (3R,4R)-4-acetamido-3-pentan-3-yloxycyclohexa-1,5-diene-1-carboxylate
ethyl (3R,4R)-4-acetamido-3-pentan-3-yloxycyclohexa-1,5-diene-1-carboxylate (PubChem CID 71047981) has the molecular formula C16H25NO4
and a molecular weight of 295.38 g/mol. Its IUPAC name is ethyl (3R,4R)-4-acetamido-3-pentan-3-yloxycyclohexa-1,5-diene-1-carboxylate.
Molecular Properties
| Compound Name | ethyl (3R,4R)-4-acetamido-3-pentan-3-yloxycyclohexa-1,5-diene-1-carboxylate |
| PubChem CID | 71047981 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | ethyl (3R,4R)-4-acetamido-3-pentan-3-yloxycyclohexa-1,5-diene-1-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@H](OC(CC)CC)[C@H](NC(C)=O)C=C1 |
| InChI | InChI=1S/C16H25NO4/c1-5-13(6-2)21-15-10-12(16(19)20-7-3)8-9-14(15)17-11(4)18/h8-10,13-15H,5-7H2,1-4H3,(H,17,18)/t14-,15-/m1/s1 |
| InChIKey | UBCUPMBNPNXKPA-HUUCEWRRSA-N |
| XLogP | 2.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (3R,4R)-4-acetamido-3-pentan-3-yloxycyclohexa-1,5-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3R,4R)-4-acetamido-3-pentan-3-yloxycyclohexa-1,5-diene-1-carboxylate?
The IUPAC name of ethyl (3R,4R)-4-acetamido-3-pentan-3-yloxycyclohexa-1,5-diene-1-carboxylate (CID 71047981) is ethyl (3R,4R)-4-acetamido-3-pentan-3-yloxycyclohexa-1,5-diene-1-carboxylate.
What is the SMILES notation for ethyl (3R,4R)-4-acetamido-3-pentan-3-yloxycyclohexa-1,5-diene-1-carboxylate?
The canonical SMILES for ethyl (3R,4R)-4-acetamido-3-pentan-3-yloxycyclohexa-1,5-diene-1-carboxylate is CCOC(=O)C1=C[C@@H](OC(CC)CC)[C@H](NC(C)=O)C=C1.
What is the InChIKey of ethyl (3R,4R)-4-acetamido-3-pentan-3-yloxycyclohexa-1,5-diene-1-carboxylate?
The InChIKey is UBCUPMBNPNXKPA-HUUCEWRRSA-N. The full InChI is InChI=1S/C16H25NO4/c1-5-13(6-2)21-15-10-12(16(19)20-7-3)8-9-14(15)17-11(4)18/h8-10,13-15H,5-7H2,1-4H3,(H,17,18)/t14-,15-/m1/s1.
What are the key properties of ethyl (3R,4R)-4-acetamido-3-pentan-3-yloxycyclohexa-1,5-diene-1-carboxylate?
ethyl (3R,4R)-4-acetamido-3-pentan-3-yloxycyclohexa-1,5-diene-1-carboxylate has a molecular weight of 295.38 g/mol, XLogP of 2.12, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3R,4R)-4-acetamido-3-pentan-3-yloxycyclohexa-1,5-diene-1-carboxylate is sourced from PubChem (CID 71047981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).