C14H19NO3 — CID 71048052
1-(furan-3-yl)-2-(1-hydroxy-2,2,5,5-tetramethylpyrrol-3-yl)ethanone (PubChem CID 71048052) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 1-(furan-3-yl)-2-(1-hydroxy-2,2,5,5-tetramethylpyrrol-3-yl)ethanone.
| Compound Name | 1-(furan-3-yl)-2-(1-hydroxy-2,2,5,5-tetramethylpyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 71048052 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 1-(furan-3-yl)-2-(1-hydroxy-2,2,5,5-tetramethylpyrrol-3-yl)ethanone |
| SMILES | CC1(C)C=C(CC(=O)c2ccoc2)C(C)(C)N1O |
| InChI | InChI=1S/C14H19NO3/c1-13(2)8-11(14(3,4)15(13)17)7-12(16)10-5-6-18-9-10/h5-6,8-9,17H,7H2,1-4H3 |
| InChIKey | YKNFJJZTMVGBRB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|