About amino-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanol
amino-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanol (PubChem CID 71048077) has the molecular formula C8H15F3N2O
and a molecular weight of 212.21 g/mol. Its IUPAC name is amino-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanol.
Molecular Properties
| Compound Name | amino-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanol |
| PubChem CID | 71048077 |
| Molecular Formula | C8H15F3N2O |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | amino-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanol |
| SMILES | NC(O)C1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C8H15F3N2O/c9-8(10,11)5-13-3-1-6(2-4-13)7(12)14/h6-7,14H,1-5,12H2 |
| InChIKey | DYPGNKXNLSRCFW-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze amino-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanol?
The IUPAC name of amino-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanol (CID 71048077) is amino-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanol.
What is the SMILES notation for amino-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanol?
The canonical SMILES for amino-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanol is NC(O)C1CCN(CC(F)(F)F)CC1.
What is the InChIKey of amino-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanol?
The InChIKey is DYPGNKXNLSRCFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F3N2O/c9-8(10,11)5-13-3-1-6(2-4-13)7(12)14/h6-7,14H,1-5,12H2.
What are the key properties of amino-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanol?
amino-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanol has a molecular weight of 212.21 g/mol, XLogP of 0.54, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for amino-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methanol is sourced from PubChem (CID 71048077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).