C17H18O4 — CID 71048430
(1R,5S,6R)-6-ethyl-5-hydroxy-11-(hydroxymethyl)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-3,8(13),9,11-tetraen-2-one (PubChem CID 71048430) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is (1R,5S,6R)-6-ethyl-5-hydroxy-11-(hydroxymethyl)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-3,8(13),9,11-tetraen-2-one.
| Compound Name | (1R,5S,6R)-6-ethyl-5-hydroxy-11-(hydroxymethyl)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-3,8(13),9,11-tetraen-2-one |
|---|---|
| PubChem CID | 71048430 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (1R,5S,6R)-6-ethyl-5-hydroxy-11-(hydroxymethyl)-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-3,8(13),9,11-tetraen-2-one |
| SMILES | CC[C@@H]1Cc2ccc(CO)c3c2C2[C@@H](O3)C(=O)C=C[C@]21O |
| InChI | InChI=1S/C17H18O4/c1-2-11-7-9-3-4-10(8-18)15-13(9)14-16(21-15)12(19)5-6-17(11,14)20/h3-6,11,14,16,18,20H,2,7-8H2,1H3/t11-,14?,16+,17-/m1/s1 |
| InChIKey | FOWPEZLTCRYVTB-AMQMXLKDSA-N |
| XLogP | 1.48 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |