About 6-methyl-5-phenylfuro[2,3-d]pyrimidin-4-amine
6-methyl-5-phenylfuro[2,3-d]pyrimidin-4-amine (PubChem CID 71048556) has the molecular formula C13H11N3O
and a molecular weight of 225.25 g/mol. Its IUPAC name is 6-methyl-5-phenylfuro[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-methyl-5-phenylfuro[2,3-d]pyrimidin-4-amine |
| PubChem CID | 71048556 |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 6-methyl-5-phenylfuro[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1oc2ncnc(N)c2c1-c1ccccc1 |
| InChI | InChI=1S/C13H11N3O/c1-8-10(9-5-3-2-4-6-9)11-12(14)15-7-16-13(11)17-8/h2-7H,1H3,(H2,14,15,16) |
| InChIKey | BBKUNPBSJCFQOY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methyl-5-phenylfuro[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5-phenylfuro[2,3-d]pyrimidin-4-amine?
The IUPAC name of 6-methyl-5-phenylfuro[2,3-d]pyrimidin-4-amine (CID 71048556) is 6-methyl-5-phenylfuro[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 6-methyl-5-phenylfuro[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 6-methyl-5-phenylfuro[2,3-d]pyrimidin-4-amine is Cc1oc2ncnc(N)c2c1-c1ccccc1.
What is the InChIKey of 6-methyl-5-phenylfuro[2,3-d]pyrimidin-4-amine?
The InChIKey is BBKUNPBSJCFQOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O/c1-8-10(9-5-3-2-4-6-9)11-12(14)15-7-16-13(11)17-8/h2-7H,1H3,(H2,14,15,16).
What are the key properties of 6-methyl-5-phenylfuro[2,3-d]pyrimidin-4-amine?
6-methyl-5-phenylfuro[2,3-d]pyrimidin-4-amine has a molecular weight of 225.25 g/mol, XLogP of 2.78, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5-phenylfuro[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 71048556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).