C17H19ClN2O2 — CID 71048980
3-[(2-chlorophenyl)methylamino]-5-propan-2-yloxybenzamide (PubChem CID 71048980) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methylamino]-5-propan-2-yloxybenzamide.
| Compound Name | 3-[(2-chlorophenyl)methylamino]-5-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 71048980 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 3-[(2-chlorophenyl)methylamino]-5-propan-2-yloxybenzamide |
| SMILES | CC(C)Oc1cc(NCc2ccccc2Cl)cc(C(N)=O)c1 |
| InChI | InChI=1S/C17H19ClN2O2/c1-11(2)22-15-8-13(17(19)21)7-14(9-15)20-10-12-5-3-4-6-16(12)18/h3-9,11,20H,10H2,1-2H3,(H2,19,21) |
| InChIKey | SKGPEHIYYVESKQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |