About naphtho[2,3-b]thioxanthene-7,12,14-trione
naphtho[2,3-b]thioxanthene-7,12,14-trione (PubChem CID 71049201) has the molecular formula C21H10O3S
and a molecular weight of 342.38 g/mol. Its IUPAC name is naphtho[2,3-b]thioxanthene-7,12,14-trione.
Molecular Properties
| Compound Name | naphtho[2,3-b]thioxanthene-7,12,14-trione |
| PubChem CID | 71049201 |
| Molecular Formula | C21H10O3S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | naphtho[2,3-b]thioxanthene-7,12,14-trione |
| SMILES | O=C1c2ccccc2C(=O)c2cc3c(=O)c4ccccc4sc3cc21 |
| InChI | InChI=1S/C21H10O3S/c22-19-11-5-1-2-6-12(11)20(23)15-10-18-16(9-14(15)19)21(24)13-7-3-4-8-17(13)25-18/h1-10H |
| InChIKey | KLWRKYNRCHYAPW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze naphtho[2,3-b]thioxanthene-7,12,14-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphtho[2,3-b]thioxanthene-7,12,14-trione?
The IUPAC name of naphtho[2,3-b]thioxanthene-7,12,14-trione (CID 71049201) is naphtho[2,3-b]thioxanthene-7,12,14-trione.
What is the SMILES notation for naphtho[2,3-b]thioxanthene-7,12,14-trione?
The canonical SMILES for naphtho[2,3-b]thioxanthene-7,12,14-trione is O=C1c2ccccc2C(=O)c2cc3c(=O)c4ccccc4sc3cc21.
What is the InChIKey of naphtho[2,3-b]thioxanthene-7,12,14-trione?
The InChIKey is KLWRKYNRCHYAPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H10O3S/c22-19-11-5-1-2-6-12(11)20(23)15-10-18-16(9-14(15)19)21(24)13-7-3-4-8-17(13)25-18/h1-10H.
What are the key properties of naphtho[2,3-b]thioxanthene-7,12,14-trione?
naphtho[2,3-b]thioxanthene-7,12,14-trione has a molecular weight of 342.38 g/mol, XLogP of 4.19, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for naphtho[2,3-b]thioxanthene-7,12,14-trione is sourced from PubChem (CID 71049201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).