C20H22F3NO — CID 71049265
8-propan-2-yl-4-(2,4,5-trifluorophenyl)-2,3,3a,4,5,6,7,9b-octahydrofuro[3,2-c]quinoline (PubChem CID 71049265) has the molecular formula C20H22F3NO and a molecular weight of 349.40 g/mol. Its IUPAC name is 8-propan-2-yl-4-(2,4,5-trifluorophenyl)-2,3,3a,4,5,6,7,9b-octahydrofuro[3,2-c]quinoline.
| Compound Name | 8-propan-2-yl-4-(2,4,5-trifluorophenyl)-2,3,3a,4,5,6,7,9b-octahydrofuro[3,2-c]quinoline |
|---|---|
| PubChem CID | 71049265 |
| Molecular Formula | C20H22F3NO |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 8-propan-2-yl-4-(2,4,5-trifluorophenyl)-2,3,3a,4,5,6,7,9b-octahydrofuro[3,2-c]quinoline |
| SMILES | CC(C)C1=CC2=C(CC1)NC(c1cc(F)c(F)cc1F)C1CCOC21 |
| InChI | InChI=1S/C20H22F3NO/c1-10(2)11-3-4-18-14(7-11)20-12(5-6-25-20)19(24-18)13-8-16(22)17(23)9-15(13)21/h7-10,12,19-20,24H,3-6H2,1-2H3 |
| InChIKey | IBGBJWJLXIRAMN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|