C13H17NO3 — CID 71049794
9-methoxy-1,2,4,4a,5,11-hexahydro-[1,4]oxazino[3,4-c][1,4]benzoxazepine (PubChem CID 71049794) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 9-methoxy-1,2,4,4a,5,11-hexahydro-[1,4]oxazino[3,4-c][1,4]benzoxazepine.
| Compound Name | 9-methoxy-1,2,4,4a,5,11-hexahydro-[1,4]oxazino[3,4-c][1,4]benzoxazepine |
|---|---|
| PubChem CID | 71049794 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 9-methoxy-1,2,4,4a,5,11-hexahydro-[1,4]oxazino[3,4-c][1,4]benzoxazepine |
| SMILES | COc1ccc2c(c1)CN1CCOCC1CO2 |
| InChI | InChI=1S/C13H17NO3/c1-15-12-2-3-13-10(6-12)7-14-4-5-16-8-11(14)9-17-13/h2-3,6,11H,4-5,7-9H2,1H3 |
| InChIKey | AVWGMQFWFIUIFJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |