About 4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-3,6-dihydro-2H-pyridine
4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-3,6-dihydro-2H-pyridine (PubChem CID 71049797) has the molecular formula C16H21FN4O
and a molecular weight of 304.37 g/mol. Its IUPAC name is 4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-3,6-dihydro-2H-pyridine |
| PubChem CID | 71049797 |
| Molecular Formula | C16H21FN4O |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-3,6-dihydro-2H-pyridine |
| SMILES | CO[C@H](c1ccc(C2=CCN(C)CC2)cc1)[C@@H](CF)N=[N+]=[N-] |
| InChI | InChI=1S/C16H21FN4O/c1-21-9-7-13(8-10-21)12-3-5-14(6-4-12)16(22-2)15(11-17)19-20-18/h3-7,15-16H,8-11H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | NNBWYUDBICAMPP-HZPDHXFCSA-N |
| XLogP | 3.74 |
| TPSA | 61.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-3,6-dihydro-2H-pyridine?
The IUPAC name of 4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-3,6-dihydro-2H-pyridine (CID 71049797) is 4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-3,6-dihydro-2H-pyridine is CO[C@H](c1ccc(C2=CCN(C)CC2)cc1)[C@@H](CF)N=[N+]=[N-].
What is the InChIKey of 4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-3,6-dihydro-2H-pyridine?
The InChIKey is NNBWYUDBICAMPP-HZPDHXFCSA-N. The full InChI is InChI=1S/C16H21FN4O/c1-21-9-7-13(8-10-21)12-3-5-14(6-4-12)16(22-2)15(11-17)19-20-18/h3-7,15-16H,8-11H2,1-2H3/t15-,16-/m1/s1.
What are the key properties of 4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-3,6-dihydro-2H-pyridine?
4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-3,6-dihydro-2H-pyridine has a molecular weight of 304.37 g/mol, XLogP of 3.74, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(1R,2S)-2-azido-3-fluoro-1-methoxypropyl]phenyl]-1-methyl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 71049797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).