About (1R,2S)-2-amino-1-[4-(1,1-dioxothiolan-3-yl)phenyl]-3-fluoropropan-1-ol
(1R,2S)-2-amino-1-[4-(1,1-dioxothiolan-3-yl)phenyl]-3-fluoropropan-1-ol (PubChem CID 71050039) has the molecular formula C13H18FNO3S
and a molecular weight of 287.36 g/mol. Its IUPAC name is (1R,2S)-2-amino-1-[4-(1,1-dioxothiolan-3-yl)phenyl]-3-fluoropropan-1-ol.
Molecular Properties
| Compound Name | (1R,2S)-2-amino-1-[4-(1,1-dioxothiolan-3-yl)phenyl]-3-fluoropropan-1-ol |
| PubChem CID | 71050039 |
| Molecular Formula | C13H18FNO3S |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | (1R,2S)-2-amino-1-[4-(1,1-dioxothiolan-3-yl)phenyl]-3-fluoropropan-1-ol |
| SMILES | N[C@H](CF)[C@H](O)c1ccc(C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C13H18FNO3S/c14-7-12(15)13(16)10-3-1-9(2-4-10)11-5-6-19(17,18)8-11/h1-4,11-13,16H,5-8,15H2/t11?,12-,13-/m1/s1 |
| InChIKey | VACALSPGEPDTNZ-VFRRUGBOSA-N |
| XLogP | 0.92 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1R,2S)-2-amino-1-[4-(1,1-dioxothiolan-3-yl)phenyl]-3-fluoropropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2S)-2-amino-1-[4-(1,1-dioxothiolan-3-yl)phenyl]-3-fluoropropan-1-ol?
The IUPAC name of (1R,2S)-2-amino-1-[4-(1,1-dioxothiolan-3-yl)phenyl]-3-fluoropropan-1-ol (CID 71050039) is (1R,2S)-2-amino-1-[4-(1,1-dioxothiolan-3-yl)phenyl]-3-fluoropropan-1-ol.
What is the SMILES notation for (1R,2S)-2-amino-1-[4-(1,1-dioxothiolan-3-yl)phenyl]-3-fluoropropan-1-ol?
The canonical SMILES for (1R,2S)-2-amino-1-[4-(1,1-dioxothiolan-3-yl)phenyl]-3-fluoropropan-1-ol is N[C@H](CF)[C@H](O)c1ccc(C2CCS(=O)(=O)C2)cc1.
What is the InChIKey of (1R,2S)-2-amino-1-[4-(1,1-dioxothiolan-3-yl)phenyl]-3-fluoropropan-1-ol?
The InChIKey is VACALSPGEPDTNZ-VFRRUGBOSA-N. The full InChI is InChI=1S/C13H18FNO3S/c14-7-12(15)13(16)10-3-1-9(2-4-10)11-5-6-19(17,18)8-11/h1-4,11-13,16H,5-8,15H2/t11?,12-,13-/m1/s1.
What are the key properties of (1R,2S)-2-amino-1-[4-(1,1-dioxothiolan-3-yl)phenyl]-3-fluoropropan-1-ol?
(1R,2S)-2-amino-1-[4-(1,1-dioxothiolan-3-yl)phenyl]-3-fluoropropan-1-ol has a molecular weight of 287.36 g/mol, XLogP of 0.92, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2S)-2-amino-1-[4-(1,1-dioxothiolan-3-yl)phenyl]-3-fluoropropan-1-ol is sourced from PubChem (CID 71050039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).