About 2-(2,6-difluorophenyl)-1,3-oxazole-4,5-diamine
2-(2,6-difluorophenyl)-1,3-oxazole-4,5-diamine (PubChem CID 71050186) has the molecular formula C9H7F2N3O
and a molecular weight of 211.17 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-1,3-oxazole-4,5-diamine.
Molecular Properties
| Compound Name | 2-(2,6-difluorophenyl)-1,3-oxazole-4,5-diamine |
| PubChem CID | 71050186 |
| Molecular Formula | C9H7F2N3O |
| Molecular Weight | 211.17 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 2-(2,6-difluorophenyl)-1,3-oxazole-4,5-diamine |
| SMILES | Nc1nc(-c2c(F)cccc2F)oc1N |
| InChI | InChI=1S/C9H7F2N3O/c10-4-2-1-3-5(11)6(4)9-14-7(12)8(13)15-9/h1-3H,12-13H2 |
| InChIKey | DGMROEIYVMQCFB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.17 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2,6-difluorophenyl)-1,3-oxazole-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-difluorophenyl)-1,3-oxazole-4,5-diamine?
The IUPAC name of 2-(2,6-difluorophenyl)-1,3-oxazole-4,5-diamine (CID 71050186) is 2-(2,6-difluorophenyl)-1,3-oxazole-4,5-diamine.
What is the SMILES notation for 2-(2,6-difluorophenyl)-1,3-oxazole-4,5-diamine?
The canonical SMILES for 2-(2,6-difluorophenyl)-1,3-oxazole-4,5-diamine is Nc1nc(-c2c(F)cccc2F)oc1N.
What is the InChIKey of 2-(2,6-difluorophenyl)-1,3-oxazole-4,5-diamine?
The InChIKey is DGMROEIYVMQCFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F2N3O/c10-4-2-1-3-5(11)6(4)9-14-7(12)8(13)15-9/h1-3H,12-13H2.
What are the key properties of 2-(2,6-difluorophenyl)-1,3-oxazole-4,5-diamine?
2-(2,6-difluorophenyl)-1,3-oxazole-4,5-diamine has a molecular weight of 211.17 g/mol, XLogP of 1.78, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-difluorophenyl)-1,3-oxazole-4,5-diamine is sourced from PubChem (CID 71050186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).