C24H24N6S — CID 71050790
1-[3-[[3-(3,4-dimethylphenyl)quinolin-6-yl]methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-N,N-dimethylmethanamine (PubChem CID 71050790) has the molecular formula C24H24N6S and a molecular weight of 428.57 g/mol. Its IUPAC name is 1-[3-[[3-(3,4-dimethylphenyl)quinolin-6-yl]methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[3-[[3-(3,4-dimethylphenyl)quinolin-6-yl]methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 71050790 |
| Molecular Formula | C24H24N6S |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 1-[3-[[3-(3,4-dimethylphenyl)quinolin-6-yl]methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-N,N-dimethylmethanamine |
| SMILES | Cc1ccc(-c2cnc3ccc(Cc4nnc5sc(CN(C)C)nn45)cc3c2)cc1C |
| InChI | InChI=1S/C24H24N6S/c1-15-5-7-18(9-16(15)2)20-12-19-10-17(6-8-21(19)25-13-20)11-22-26-27-24-30(22)28-23(31-24)14-29(3)4/h5-10,12-13H,11,14H2,1-4H3 |
| InChIKey | BIIBSAAHLATQAP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 59.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |