C26H31ClN4O4 — CID 71051578
[(1S,2R,4R)-4-methyl-2-propan-2-ylcyclohexyl] (1R,6S)-4-(3-chloro-4-cyano-2-methylphenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylate (PubChem CID 71051578) has the molecular formula C26H31ClN4O4 and a molecular weight of 499.01 g/mol. Its IUPAC name is [(1S,2R,4R)-4-methyl-2-propan-2-ylcyclohexyl] (1R,6S)-4-(3-chloro-4-cyano-2-methylphenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylate.
| Compound Name | [(1S,2R,4R)-4-methyl-2-propan-2-ylcyclohexyl] (1R,6S)-4-(3-chloro-4-cyano-2-methylphenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylate |
|---|---|
| PubChem CID | 71051578 |
| Molecular Formula | C26H31ClN4O4 |
| Molecular Weight | 499.01 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | [(1S,2R,4R)-4-methyl-2-propan-2-ylcyclohexyl] (1R,6S)-4-(3-chloro-4-cyano-2-methylphenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylate |
| SMILES | Cc1c(N2C(=O)[C@@H]3C4C[C@H](CN4C(=O)O[C@H]4CC[C@@H](C)C[C@@H]4C(C)C)N3C2=O)ccc(C#N)c1Cl |
| InChI | InChI=1S/C26H31ClN4O4/c1-13(2)18-9-14(3)5-8-21(18)35-26(34)29-12-17-10-20(29)23-24(32)31(25(33)30(17)23)19-7-6-16(11-28)22(27)15(19)4/h6-7,13-14,17-18,20-21,23H,5,8-10,12H2,1-4H3/t14-,17-,18-,20?,21+,23+/m1/s1 |
| InChIKey | NVJYZGIDPXUDDD-WQMBADFHSA-N |
| XLogP | 4.71 |
| TPSA | 93.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.01 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|