C19H19N5O5 — CID 71051615
methyl 4-[(1R,6S)-4-(6-cyano-5-methyl-3-pyridinyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-8-yl]-4-oxobutanoate (PubChem CID 71051615) has the molecular formula C19H19N5O5 and a molecular weight of 397.39 g/mol. Its IUPAC name is methyl 4-[(1R,6S)-4-(6-cyano-5-methyl-3-pyridinyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-8-yl]-4-oxobutanoate.
| Compound Name | methyl 4-[(1R,6S)-4-(6-cyano-5-methyl-3-pyridinyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-8-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 71051615 |
| Molecular Formula | C19H19N5O5 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | methyl 4-[(1R,6S)-4-(6-cyano-5-methyl-3-pyridinyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decan-8-yl]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)N1C[C@H]2CC1[C@H]1C(=O)N(c3cnc(C#N)c(C)c3)C(=O)N21 |
| InChI | InChI=1S/C19H19N5O5/c1-10-5-11(8-21-13(10)7-20)24-18(27)17-14-6-12(23(17)19(24)28)9-22(14)15(25)3-4-16(26)29-2/h5,8,12,14,17H,3-4,6,9H2,1-2H3/t12-,14?,17+/m1/s1 |
| InChIKey | VQKQPIMDHZBMMB-YTQWVHSASA-N |
| XLogP | 0.34 |
| TPSA | 123.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|