About N-phenyl-4-(5-phenyl-2,3-dihydrothiophen-2-yl)aniline
N-phenyl-4-(5-phenyl-2,3-dihydrothiophen-2-yl)aniline (PubChem CID 71051968) has the molecular formula C22H19NS
and a molecular weight of 329.47 g/mol. Its IUPAC name is N-phenyl-4-(5-phenyl-2,3-dihydrothiophen-2-yl)aniline.
Molecular Properties
| Compound Name | N-phenyl-4-(5-phenyl-2,3-dihydrothiophen-2-yl)aniline |
| PubChem CID | 71051968 |
| Molecular Formula | C22H19NS |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | N-phenyl-4-(5-phenyl-2,3-dihydrothiophen-2-yl)aniline |
| SMILES | C1=C(c2ccccc2)SC(c2ccc(Nc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C22H19NS/c1-3-7-17(8-4-1)21-15-16-22(24-21)18-11-13-20(14-12-18)23-19-9-5-2-6-10-19/h1-15,22-23H,16H2 |
| InChIKey | FRGFGNGUKORVSQ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-phenyl-4-(5-phenyl-2,3-dihydrothiophen-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-4-(5-phenyl-2,3-dihydrothiophen-2-yl)aniline?
The IUPAC name of N-phenyl-4-(5-phenyl-2,3-dihydrothiophen-2-yl)aniline (CID 71051968) is N-phenyl-4-(5-phenyl-2,3-dihydrothiophen-2-yl)aniline.
What is the SMILES notation for N-phenyl-4-(5-phenyl-2,3-dihydrothiophen-2-yl)aniline?
The canonical SMILES for N-phenyl-4-(5-phenyl-2,3-dihydrothiophen-2-yl)aniline is C1=C(c2ccccc2)SC(c2ccc(Nc3ccccc3)cc2)C1.
What is the InChIKey of N-phenyl-4-(5-phenyl-2,3-dihydrothiophen-2-yl)aniline?
The InChIKey is FRGFGNGUKORVSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19NS/c1-3-7-17(8-4-1)21-15-16-22(24-21)18-11-13-20(14-12-18)23-19-9-5-2-6-10-19/h1-15,22-23H,16H2.
What are the key properties of N-phenyl-4-(5-phenyl-2,3-dihydrothiophen-2-yl)aniline?
N-phenyl-4-(5-phenyl-2,3-dihydrothiophen-2-yl)aniline has a molecular weight of 329.47 g/mol, XLogP of 6.65, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-4-(5-phenyl-2,3-dihydrothiophen-2-yl)aniline is sourced from PubChem (CID 71051968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).