About (4S)-4-[(E)-3-(methoxymethyl)pent-2-enyl]-1,5,5-trimethylcyclopentene
(4S)-4-[(E)-3-(methoxymethyl)pent-2-enyl]-1,5,5-trimethylcyclopentene (PubChem CID 71052060) has the molecular formula C15H26O
and a molecular weight of 222.37 g/mol. Its IUPAC name is (4S)-4-[(E)-3-(methoxymethyl)pent-2-enyl]-1,5,5-trimethylcyclopentene.
Molecular Properties
| Compound Name | (4S)-4-[(E)-3-(methoxymethyl)pent-2-enyl]-1,5,5-trimethylcyclopentene |
| PubChem CID | 71052060 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | (4S)-4-[(E)-3-(methoxymethyl)pent-2-enyl]-1,5,5-trimethylcyclopentene |
| SMILES | CC/C(=C\C[C@@H]1CC=C(C)C1(C)C)COC |
| InChI | InChI=1S/C15H26O/c1-6-13(11-16-5)8-10-14-9-7-12(2)15(14,3)4/h7-8,14H,6,9-11H2,1-5H3/b13-8+/t14-/m0/s1 |
| InChIKey | NCKXFCRGOMTUCZ-CZAWJFPGSA-N |
| XLogP | 4.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-[(E)-3-(methoxymethyl)pent-2-enyl]-1,5,5-trimethylcyclopentene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-[(E)-3-(methoxymethyl)pent-2-enyl]-1,5,5-trimethylcyclopentene?
The IUPAC name of (4S)-4-[(E)-3-(methoxymethyl)pent-2-enyl]-1,5,5-trimethylcyclopentene (CID 71052060) is (4S)-4-[(E)-3-(methoxymethyl)pent-2-enyl]-1,5,5-trimethylcyclopentene.
What is the SMILES notation for (4S)-4-[(E)-3-(methoxymethyl)pent-2-enyl]-1,5,5-trimethylcyclopentene?
The canonical SMILES for (4S)-4-[(E)-3-(methoxymethyl)pent-2-enyl]-1,5,5-trimethylcyclopentene is CC/C(=C\C[C@@H]1CC=C(C)C1(C)C)COC.
What is the InChIKey of (4S)-4-[(E)-3-(methoxymethyl)pent-2-enyl]-1,5,5-trimethylcyclopentene?
The InChIKey is NCKXFCRGOMTUCZ-CZAWJFPGSA-N. The full InChI is InChI=1S/C15H26O/c1-6-13(11-16-5)8-10-14-9-7-12(2)15(14,3)4/h7-8,14H,6,9-11H2,1-5H3/b13-8+/t14-/m0/s1.
What are the key properties of (4S)-4-[(E)-3-(methoxymethyl)pent-2-enyl]-1,5,5-trimethylcyclopentene?
(4S)-4-[(E)-3-(methoxymethyl)pent-2-enyl]-1,5,5-trimethylcyclopentene has a molecular weight of 222.37 g/mol, XLogP of 4.35, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-[(E)-3-(methoxymethyl)pent-2-enyl]-1,5,5-trimethylcyclopentene is sourced from PubChem (CID 71052060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).