C26H37N7O4 — CID 71052283
tert-butyl 3-[[2-cyano-7-(2,2-dimethylpropyl)-5,6-dihydropyrrolo[2,3-d]pyrimidin-6-yl]methyl]-1-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate (PubChem CID 71052283) has the molecular formula C26H37N7O4 and a molecular weight of 511.63 g/mol. Its IUPAC name is tert-butyl 3-[[2-cyano-7-(2,2-dimethylpropyl)-5,6-dihydropyrrolo[2,3-d]pyrimidin-6-yl]methyl]-1-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl 3-[[2-cyano-7-(2,2-dimethylpropyl)-5,6-dihydropyrrolo[2,3-d]pyrimidin-6-yl]methyl]-1-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 71052283 |
| Molecular Formula | C26H37N7O4 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | tert-butyl 3-[[2-cyano-7-(2,2-dimethylpropyl)-5,6-dihydropyrrolo[2,3-d]pyrimidin-6-yl]methyl]-1-methyl-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
| SMILES | CN1C(=O)N(CC2Cc3cnc(C#N)nc3N2CC(C)(C)C)C(=O)C12CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C26H37N7O4/c1-24(2,3)16-33-18(12-17-14-28-19(13-27)29-20(17)33)15-32-21(34)26(30(7)22(32)35)8-10-31(11-9-26)23(36)37-25(4,5)6/h14,18H,8-12,15-16H2,1-7H3 |
| InChIKey | NJJNRKVTJGNQMO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 122.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|