C24H38O4 — CID 71052698
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2,2,3,3,6-pentamethyl-5-phenylheptanoate (PubChem CID 71052698) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2,2,3,3,6-pentamethyl-5-phenylheptanoate.
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2,2,3,3,6-pentamethyl-5-phenylheptanoate |
|---|---|
| PubChem CID | 71052698 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 2,2,3,3,6-pentamethyl-5-phenylheptanoate |
| SMILES | CC(C)C(CC(C)(C)C(C)(C)C(=O)OCC1COC(C)(C)O1)c1ccccc1 |
| InChI | InChI=1S/C24H38O4/c1-17(2)20(18-12-10-9-11-13-18)14-22(3,4)23(5,6)21(25)26-15-19-16-27-24(7,8)28-19/h9-13,17,19-20H,14-16H2,1-8H3 |
| InChIKey | KGUJJYVPZPHAPB-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |