About ethyl 5-tert-butylsulfanyl-4-cycloprop-2-en-1-ylidene-2,2-dimethylpentanoate
ethyl 5-tert-butylsulfanyl-4-cycloprop-2-en-1-ylidene-2,2-dimethylpentanoate (PubChem CID 71052834) has the molecular formula C16H26O2S
and a molecular weight of 282.45 g/mol. Its IUPAC name is ethyl 5-tert-butylsulfanyl-4-cycloprop-2-en-1-ylidene-2,2-dimethylpentanoate.
Molecular Properties
| Compound Name | ethyl 5-tert-butylsulfanyl-4-cycloprop-2-en-1-ylidene-2,2-dimethylpentanoate |
| PubChem CID | 71052834 |
| Molecular Formula | C16H26O2S |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | ethyl 5-tert-butylsulfanyl-4-cycloprop-2-en-1-ylidene-2,2-dimethylpentanoate |
| SMILES | CCOC(=O)C(C)(C)CC(CSC(C)(C)C)=C1C=C1 |
| InChI | InChI=1S/C16H26O2S/c1-7-18-14(17)16(5,6)10-13(12-8-9-12)11-19-15(2,3)4/h8-9H,7,10-11H2,1-6H3 |
| InChIKey | GDJWNNMLORDRAI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 5-tert-butylsulfanyl-4-cycloprop-2-en-1-ylidene-2,2-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-tert-butylsulfanyl-4-cycloprop-2-en-1-ylidene-2,2-dimethylpentanoate?
The IUPAC name of ethyl 5-tert-butylsulfanyl-4-cycloprop-2-en-1-ylidene-2,2-dimethylpentanoate (CID 71052834) is ethyl 5-tert-butylsulfanyl-4-cycloprop-2-en-1-ylidene-2,2-dimethylpentanoate.
What is the SMILES notation for ethyl 5-tert-butylsulfanyl-4-cycloprop-2-en-1-ylidene-2,2-dimethylpentanoate?
The canonical SMILES for ethyl 5-tert-butylsulfanyl-4-cycloprop-2-en-1-ylidene-2,2-dimethylpentanoate is CCOC(=O)C(C)(C)CC(CSC(C)(C)C)=C1C=C1.
What is the InChIKey of ethyl 5-tert-butylsulfanyl-4-cycloprop-2-en-1-ylidene-2,2-dimethylpentanoate?
The InChIKey is GDJWNNMLORDRAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O2S/c1-7-18-14(17)16(5,6)10-13(12-8-9-12)11-19-15(2,3)4/h8-9H,7,10-11H2,1-6H3.
What are the key properties of ethyl 5-tert-butylsulfanyl-4-cycloprop-2-en-1-ylidene-2,2-dimethylpentanoate?
ethyl 5-tert-butylsulfanyl-4-cycloprop-2-en-1-ylidene-2,2-dimethylpentanoate has a molecular weight of 282.45 g/mol, XLogP of 4.36, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-tert-butylsulfanyl-4-cycloprop-2-en-1-ylidene-2,2-dimethylpentanoate is sourced from PubChem (CID 71052834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).