About 1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]-3-methoxypropan-2-ol
1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]-3-methoxypropan-2-ol (PubChem CID 71052921) has the molecular formula C14H30N2O2
and a molecular weight of 258.41 g/mol. Its IUPAC name is 1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]-3-methoxypropan-2-ol.
Molecular Properties
| Compound Name | 1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]-3-methoxypropan-2-ol |
| PubChem CID | 71052921 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | 1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]-3-methoxypropan-2-ol |
| SMILES | COCC(O)CNCC1(C)CC(N)CC(C)(C)C1 |
| InChI | InChI=1S/C14H30N2O2/c1-13(2)5-11(15)6-14(3,9-13)10-16-7-12(17)8-18-4/h11-12,16-17H,5-10,15H2,1-4H3 |
| InChIKey | SKVSIXOSVJMIOS-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]-3-methoxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]-3-methoxypropan-2-ol?
The IUPAC name of 1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]-3-methoxypropan-2-ol (CID 71052921) is 1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]-3-methoxypropan-2-ol.
What is the SMILES notation for 1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]-3-methoxypropan-2-ol?
The canonical SMILES for 1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]-3-methoxypropan-2-ol is COCC(O)CNCC1(C)CC(N)CC(C)(C)C1.
What is the InChIKey of 1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]-3-methoxypropan-2-ol?
The InChIKey is SKVSIXOSVJMIOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N2O2/c1-13(2)5-11(15)6-14(3,9-13)10-16-7-12(17)8-18-4/h11-12,16-17H,5-10,15H2,1-4H3.
What are the key properties of 1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]-3-methoxypropan-2-ol?
1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]-3-methoxypropan-2-ol has a molecular weight of 258.41 g/mol, XLogP of 1.13, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]-3-methoxypropan-2-ol is sourced from PubChem (CID 71052921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).