About 4,4-difluoro-3-methyltricyclo[4.2.1.02,5]non-7-ene-3-carboxylic acid
4,4-difluoro-3-methyltricyclo[4.2.1.02,5]non-7-ene-3-carboxylic acid (PubChem CID 71053098) has the molecular formula C11H12F2O2
and a molecular weight of 214.21 g/mol. Its IUPAC name is 4,4-difluoro-3-methyltricyclo[4.2.1.02,5]non-7-ene-3-carboxylic acid.
Molecular Properties
| Compound Name | 4,4-difluoro-3-methyltricyclo[4.2.1.02,5]non-7-ene-3-carboxylic acid |
| PubChem CID | 71053098 |
| Molecular Formula | C11H12F2O2 |
| Molecular Weight | 214.21 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 4,4-difluoro-3-methyltricyclo[4.2.1.02,5]non-7-ene-3-carboxylic acid |
| SMILES | CC1(C(=O)O)C2C3C=CC(C3)C2C1(F)F |
| InChI | InChI=1S/C11H12F2O2/c1-10(9(14)15)7-5-2-3-6(4-5)8(7)11(10,12)13/h2-3,5-8H,4H2,1H3,(H,14,15) |
| InChIKey | ZFZYJAIPZVEIKP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.21 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,4-difluoro-3-methyltricyclo[4.2.1.02,5]non-7-ene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoro-3-methyltricyclo[4.2.1.02,5]non-7-ene-3-carboxylic acid?
The IUPAC name of 4,4-difluoro-3-methyltricyclo[4.2.1.02,5]non-7-ene-3-carboxylic acid (CID 71053098) is 4,4-difluoro-3-methyltricyclo[4.2.1.02,5]non-7-ene-3-carboxylic acid.
What is the SMILES notation for 4,4-difluoro-3-methyltricyclo[4.2.1.02,5]non-7-ene-3-carboxylic acid?
The canonical SMILES for 4,4-difluoro-3-methyltricyclo[4.2.1.02,5]non-7-ene-3-carboxylic acid is CC1(C(=O)O)C2C3C=CC(C3)C2C1(F)F.
What is the InChIKey of 4,4-difluoro-3-methyltricyclo[4.2.1.02,5]non-7-ene-3-carboxylic acid?
The InChIKey is ZFZYJAIPZVEIKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F2O2/c1-10(9(14)15)7-5-2-3-6(4-5)8(7)11(10,12)13/h2-3,5-8H,4H2,1H3,(H,14,15).
What are the key properties of 4,4-difluoro-3-methyltricyclo[4.2.1.02,5]non-7-ene-3-carboxylic acid?
4,4-difluoro-3-methyltricyclo[4.2.1.02,5]non-7-ene-3-carboxylic acid has a molecular weight of 214.21 g/mol, XLogP of 2.16, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-3-methyltricyclo[4.2.1.02,5]non-7-ene-3-carboxylic acid is sourced from PubChem (CID 71053098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).