C17H12FN3OS — CID 71053572
7-fluoro-1-[(2-methyl-3-pyridinyl)methylsulfanyl]-3-oxo-2H-isoquinoline-4-carbonitrile (PubChem CID 71053572) has the molecular formula C17H12FN3OS and a molecular weight of 325.37 g/mol. Its IUPAC name is 7-fluoro-1-[(2-methyl-3-pyridinyl)methylsulfanyl]-3-oxo-2H-isoquinoline-4-carbonitrile.
| Compound Name | 7-fluoro-1-[(2-methyl-3-pyridinyl)methylsulfanyl]-3-oxo-2H-isoquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 71053572 |
| Molecular Formula | C17H12FN3OS |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 7-fluoro-1-[(2-methyl-3-pyridinyl)methylsulfanyl]-3-oxo-2H-isoquinoline-4-carbonitrile |
| SMILES | Cc1ncccc1CSc1[nH]c(=O)c(C#N)c2ccc(F)cc12 |
| InChI | InChI=1S/C17H12FN3OS/c1-10-11(3-2-6-20-10)9-23-17-14-7-12(18)4-5-13(14)15(8-19)16(22)21-17/h2-7H,9H2,1H3,(H,21,22) |
| InChIKey | DSCACHHLNZCEJN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |