About 2-[4-(3,5-difluoro-4-methylcyclohexyl)-3-fluorocyclohexyl]-5-methyloxane
2-[4-(3,5-difluoro-4-methylcyclohexyl)-3-fluorocyclohexyl]-5-methyloxane (PubChem CID 71053788) has the molecular formula C19H31F3O
and a molecular weight of 332.45 g/mol. Its IUPAC name is 2-[4-(3,5-difluoro-4-methylcyclohexyl)-3-fluorocyclohexyl]-5-methyloxane.
Molecular Properties
| Compound Name | 2-[4-(3,5-difluoro-4-methylcyclohexyl)-3-fluorocyclohexyl]-5-methyloxane |
| PubChem CID | 71053788 |
| Molecular Formula | C19H31F3O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 2-[4-(3,5-difluoro-4-methylcyclohexyl)-3-fluorocyclohexyl]-5-methyloxane |
| SMILES | CC1CCC(C2CCC(C3CC(F)C(C)C(F)C3)C(F)C2)OC1 |
| InChI | InChI=1S/C19H31F3O/c1-11-3-6-19(23-10-11)13-4-5-15(18(22)7-13)14-8-16(20)12(2)17(21)9-14/h11-19H,3-10H2,1-2H3 |
| InChIKey | UJLNAULMAIJZTN-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[4-(3,5-difluoro-4-methylcyclohexyl)-3-fluorocyclohexyl]-5-methyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3,5-difluoro-4-methylcyclohexyl)-3-fluorocyclohexyl]-5-methyloxane?
The IUPAC name of 2-[4-(3,5-difluoro-4-methylcyclohexyl)-3-fluorocyclohexyl]-5-methyloxane (CID 71053788) is 2-[4-(3,5-difluoro-4-methylcyclohexyl)-3-fluorocyclohexyl]-5-methyloxane.
What is the SMILES notation for 2-[4-(3,5-difluoro-4-methylcyclohexyl)-3-fluorocyclohexyl]-5-methyloxane?
The canonical SMILES for 2-[4-(3,5-difluoro-4-methylcyclohexyl)-3-fluorocyclohexyl]-5-methyloxane is CC1CCC(C2CCC(C3CC(F)C(C)C(F)C3)C(F)C2)OC1.
What is the InChIKey of 2-[4-(3,5-difluoro-4-methylcyclohexyl)-3-fluorocyclohexyl]-5-methyloxane?
The InChIKey is UJLNAULMAIJZTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31F3O/c1-11-3-6-19(23-10-11)13-4-5-15(18(22)7-13)14-8-16(20)12(2)17(21)9-14/h11-19H,3-10H2,1-2H3.
What are the key properties of 2-[4-(3,5-difluoro-4-methylcyclohexyl)-3-fluorocyclohexyl]-5-methyloxane?
2-[4-(3,5-difluoro-4-methylcyclohexyl)-3-fluorocyclohexyl]-5-methyloxane has a molecular weight of 332.45 g/mol, XLogP of 5.28, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3,5-difluoro-4-methylcyclohexyl)-3-fluorocyclohexyl]-5-methyloxane is sourced from PubChem (CID 71053788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).