C15H19N — CID 71053972
2,5-dimethyl-5-[(Z)-prop-1-enyl]-9-azatricyclo[5.4.0.01,4]undeca-6,8,10-triene (PubChem CID 71053972) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 2,5-dimethyl-5-[(Z)-prop-1-enyl]-9-azatricyclo[5.4.0.01,4]undeca-6,8,10-triene.
| Compound Name | 2,5-dimethyl-5-[(Z)-prop-1-enyl]-9-azatricyclo[5.4.0.01,4]undeca-6,8,10-triene |
|---|---|
| PubChem CID | 71053972 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2,5-dimethyl-5-[(Z)-prop-1-enyl]-9-azatricyclo[5.4.0.01,4]undeca-6,8,10-triene |
| SMILES | C/C=C\C1(C)C=C2C=NC=CC23C(C)CC13 |
| InChI | InChI=1S/C15H19N/c1-4-5-14(3)9-12-10-16-7-6-15(12)11(2)8-13(14)15/h4-7,9-11,13H,8H2,1-3H3/b5-4- |
| InChIKey | ZKVLDIAGTIGRDM-PLNGDYQASA-N |
| XLogP | 3.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|