C25H27FN4O2 — CID 71055004
8-[[(3R,4S)-3-fluoropiperidin-4-yl]methyl]-2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]quinoline (PubChem CID 71055004) has the molecular formula C25H27FN4O2 and a molecular weight of 434.52 g/mol. Its IUPAC name is 8-[[(3R,4S)-3-fluoropiperidin-4-yl]methyl]-2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]quinoline.
| Compound Name | 8-[[(3R,4S)-3-fluoropiperidin-4-yl]methyl]-2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]quinoline |
|---|---|
| PubChem CID | 71055004 |
| Molecular Formula | C25H27FN4O2 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 8-[[(3R,4S)-3-fluoropiperidin-4-yl]methyl]-2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]quinoline |
| SMILES | COCCOc1ccn2c(-c3ccc4cccc(C[C@H]5CCNC[C@@H]5F)c4n3)cnc2c1 |
| InChI | InChI=1S/C25H27FN4O2/c1-31-11-12-32-20-8-10-30-23(16-28-24(30)14-20)22-6-5-17-3-2-4-19(25(17)29-22)13-18-7-9-27-15-21(18)26/h2-6,8,10,14,16,18,21,27H,7,9,11-13,15H2,1H3/t18-,21+/m1/s1 |
| InChIKey | MAPWVHJFEZLMSN-NQIIRXRSSA-N |
| XLogP | 4.06 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|