About 6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide
6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 71055328) has the molecular formula C17H16N2OS
and a molecular weight of 296.40 g/mol. Its IUPAC name is 6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide.
Molecular Properties
| Compound Name | 6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide |
| PubChem CID | 71055328 |
| Molecular Formula | C17H16N2OS |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CCCC1=Nc2cc(C(N)=O)ccc2Sc2ccccc21 |
| InChI | InChI=1S/C17H16N2OS/c1-2-5-13-12-6-3-4-7-15(12)21-16-9-8-11(17(18)20)10-14(16)19-13/h3-4,6-10H,2,5H2,1H3,(H2,18,20) |
| InChIKey | IDESJYPUUHZXHU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide?
The IUPAC name of 6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide (CID 71055328) is 6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide.
What is the SMILES notation for 6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide?
The canonical SMILES for 6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide is CCCC1=Nc2cc(C(N)=O)ccc2Sc2ccccc21.
What is the InChIKey of 6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide?
The InChIKey is IDESJYPUUHZXHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2OS/c1-2-5-13-12-6-3-4-7-15(12)21-16-9-8-11(17(18)20)10-14(16)19-13/h3-4,6-10H,2,5H2,1H3,(H2,18,20).
What are the key properties of 6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide?
6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide has a molecular weight of 296.40 g/mol, XLogP of 4.17, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide is sourced from PubChem (CID 71055328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).