C21H31N5O — CID 71055342
N-benzyl-N,1-dimethyl-4-morpholin-4-yl-2,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-2-amine (PubChem CID 71055342) has the molecular formula C21H31N5O and a molecular weight of 369.51 g/mol. Its IUPAC name is N-benzyl-N,1-dimethyl-4-morpholin-4-yl-2,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-2-amine.
| Compound Name | N-benzyl-N,1-dimethyl-4-morpholin-4-yl-2,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-2-amine |
|---|---|
| PubChem CID | 71055342 |
| Molecular Formula | C21H31N5O |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | N-benzyl-N,1-dimethyl-4-morpholin-4-yl-2,5,6,7,8,9-hexahydropyrimido[4,5-d]azepin-2-amine |
| SMILES | CN(Cc1ccccc1)C1N=C(N2CCOCC2)C2=C(CCNCC2)N1C |
| InChI | InChI=1S/C21H31N5O/c1-24(16-17-6-4-3-5-7-17)21-23-20(26-12-14-27-15-13-26)18-8-10-22-11-9-19(18)25(21)2/h3-7,21-22H,8-16H2,1-2H3 |
| InChIKey | LVZBBCGLSIGBRJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |