C17H15ClN2O6S2 — CID 71055563
N-(4-chloro-3-methyl-1,2-oxazol-5-yl)-2-[2-(4,5-dihydroxy-2-methylphenyl)acetyl]thiophene-3-sulfonamide (PubChem CID 71055563) has the molecular formula C17H15ClN2O6S2 and a molecular weight of 442.90 g/mol. Its IUPAC name is N-(4-chloro-3-methyl-1,2-oxazol-5-yl)-2-[2-(4,5-dihydroxy-2-methylphenyl)acetyl]thiophene-3-sulfonamide.
| Compound Name | N-(4-chloro-3-methyl-1,2-oxazol-5-yl)-2-[2-(4,5-dihydroxy-2-methylphenyl)acetyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 71055563 |
| Molecular Formula | C17H15ClN2O6S2 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | N-(4-chloro-3-methyl-1,2-oxazol-5-yl)-2-[2-(4,5-dihydroxy-2-methylphenyl)acetyl]thiophene-3-sulfonamide |
| SMILES | Cc1cc(O)c(O)cc1CC(=O)c1sccc1S(=O)(=O)Nc1onc(C)c1Cl |
| InChI | InChI=1S/C17H15ClN2O6S2/c1-8-5-11(21)12(22)6-10(8)7-13(23)16-14(3-4-27-16)28(24,25)20-17-15(18)9(2)19-26-17/h3-6,20-22H,7H2,1-2H3 |
| InChIKey | KOCOSDIVSKAZIJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|