C25H32F3N6O4P — CID 71055617
dibutyl 3-[[1-(1H-pyrazol-5-yl)-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propyl phosphate (PubChem CID 71055617) has the molecular formula C25H32F3N6O4P and a molecular weight of 568.54 g/mol. Its IUPAC name is dibutyl 3-[[1-(1H-pyrazol-5-yl)-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propyl phosphate.
| Compound Name | dibutyl 3-[[1-(1H-pyrazol-5-yl)-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propyl phosphate |
|---|---|
| PubChem CID | 71055617 |
| Molecular Formula | C25H32F3N6O4P |
| Molecular Weight | 568.54 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | dibutyl 3-[[1-(1H-pyrazol-5-yl)-7-(trifluoromethyl)imidazo[1,2-a]quinoxalin-4-yl]amino]propyl phosphate |
| SMILES | CCCCOP(=O)(OCCCC)OCCCNc1nc2cc(C(F)(F)F)ccc2n2c(-c3ccn[nH]3)cnc12 |
| InChI | InChI=1S/C25H32F3N6O4P/c1-3-5-13-36-39(35,37-14-6-4-2)38-15-7-11-29-23-24-30-17-22(19-10-12-31-33-19)34(24)21-9-8-18(25(26,27)28)16-20(21)32-23/h8-10,12,16-17H,3-7,11,13-15H2,1-2H3,(H,29,32)(H,31,33) |
| InChIKey | TZBXFHVKVVDWJV-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.54 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|