C20H25FN6O4 — CID 71055801
4-(2-fluoro-4-nitrophenoxy)-5-methyl-6-[2-(4-methylpiperazin-1-yl)ethoxy]-6,7-dihydropyrrolo[2,1-f][1,2,4]triazine (PubChem CID 71055801) has the molecular formula C20H25FN6O4 and a molecular weight of 432.46 g/mol. Its IUPAC name is 4-(2-fluoro-4-nitrophenoxy)-5-methyl-6-[2-(4-methylpiperazin-1-yl)ethoxy]-6,7-dihydropyrrolo[2,1-f][1,2,4]triazine.
| Compound Name | 4-(2-fluoro-4-nitrophenoxy)-5-methyl-6-[2-(4-methylpiperazin-1-yl)ethoxy]-6,7-dihydropyrrolo[2,1-f][1,2,4]triazine |
|---|---|
| PubChem CID | 71055801 |
| Molecular Formula | C20H25FN6O4 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 4-(2-fluoro-4-nitrophenoxy)-5-methyl-6-[2-(4-methylpiperazin-1-yl)ethoxy]-6,7-dihydropyrrolo[2,1-f][1,2,4]triazine |
| SMILES | CC1=C2C(Oc3ccc([N+](=O)[O-])cc3F)=NC=NN2CC1OCCN1CCN(C)CC1 |
| InChI | InChI=1S/C20H25FN6O4/c1-14-18(30-10-9-25-7-5-24(2)6-8-25)12-26-19(14)20(22-13-23-26)31-17-4-3-15(27(28)29)11-16(17)21/h3-4,11,13,18H,5-10,12H2,1-2H3 |
| InChIKey | PCRUWFXLHVGGMX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 96.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|