C13H20N2 — CID 71056621
(4aR,9bR)-2,8-dimethyl-1,3,4,4a,5,7,8,9b-octahydropyrido[4,3-b]indole (PubChem CID 71056621) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (4aR,9bR)-2,8-dimethyl-1,3,4,4a,5,7,8,9b-octahydropyrido[4,3-b]indole.
| Compound Name | (4aR,9bR)-2,8-dimethyl-1,3,4,4a,5,7,8,9b-octahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 71056621 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (4aR,9bR)-2,8-dimethyl-1,3,4,4a,5,7,8,9b-octahydropyrido[4,3-b]indole |
| SMILES | CC1C=C2C(=CC1)N[C@@H]1CCN(C)C[C@@H]21 |
| InChI | InChI=1S/C13H20N2/c1-9-3-4-12-10(7-9)11-8-15(2)6-5-13(11)14-12/h4,7,9,11,13-14H,3,5-6,8H2,1-2H3/t9?,11-,13+/m0/s1 |
| InChIKey | JGQCPNBXZPBEKI-DALSCRRLSA-N |
| XLogP | 1.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |