C13H23N3O3 — CID 71056661
(4R,6R)-4-azido-6-(butoxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole (PubChem CID 71056661) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is (4R,6R)-4-azido-6-(butoxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole.
| Compound Name | (4R,6R)-4-azido-6-(butoxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole |
|---|---|
| PubChem CID | 71056661 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | (4R,6R)-4-azido-6-(butoxymethyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole |
| SMILES | CCCCOC[C@H]1C[C@@H](N=[N+]=[N-])C2OC(C)(C)OC21 |
| InChI | InChI=1S/C13H23N3O3/c1-4-5-6-17-8-9-7-10(15-16-14)12-11(9)18-13(2,3)19-12/h9-12H,4-8H2,1-3H3/t9-,10-,11?,12?/m1/s1 |
| InChIKey | UBOZQRCDCYWELL-QYNFOATHSA-N |
| XLogP | 3.02 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|